Drugs present in MMsINC which are similar to the molecule MMscode: MMs02693672
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.75 |
MMs01724895 | Oc1cc(ccc1\C=C\c1ccc(cc1)C(N)=N)C(N)=N | 0.72 |
MMs01724839 | Oc1ncc(cc1N)-c1ccncc1 | 0.72 |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.71 |
MMs01724962 | Oc1nc(C)c(cc1C#N)-c1ccncc1 | 0.71 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01725029 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |