Drugs present in MMsINC which are similar to the molecule MMscode: MMs02687707
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.78 |
MMs01724935 | S(=O)(=O)(N)c1ccc(N2S(=O)(=O)CCCC2)cc1 | 0.76 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.72 |
MMs01725227 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.70 |
MMs01725853 | Clc1cc2NC(NS(=O)(=O)c2cc1S(=O)(=O)N)CC1CCCC1 | 0.70 |