Drugs present in MMsINC which are similar to the molecule MMscode: MMs02686144
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726736 | O(C)c1cc(C)c(\C=C\C(=C\C=C\C(=C\C(OCC)=O)\C)\C)c(C)c1C | 0.74 |
MMs01724855 | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.72 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |
MMs01725187 | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.71 |