Drugs present in MMsINC which are similar to the molecule MMscode: MMs02676916
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726782![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.73 |
MMs01726784![]() | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.73 |
MMs01724792![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.73 |
MMs01725796![]() | S1(=O)(=O)c2c(N(c3c1cccc3)CC(CN(C)C)C)cccc2 | 0.73 |
MMs01727428![]() | S1c2c(N(c3c1cccc3)CCCN1CCN(CC1)C)cc(S(=O)(=O)N(C)C)cc2 | 0.71 |
MMs01725090![]() | s1c(nnc1NS(=O)(=O)c1ccc(N)cc1)C | 0.70 |