Drugs present in MMsINC which are similar to the molecule MMscode: MMs02665353
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725104 | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.80 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725123 | Oc1ccc(cc1)CC(N)(C(O)=O)C | 0.71 |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.70 |