Drugs present in MMsINC which are similar to the molecule MMscode: MMs02661262
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725047 | S(=O)(=O)(Nc1ncc(OC)cn1)c1ccc(N)cc1 | 0.80 |
MMs01725814 | s1cccc1CN(CCN(C)C)c1ncccc1 | 0.76 |
MMs01724798 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01725150 | [NH+](CCC(c1ccccc1)c1ncccc1)(C)C | 0.70 |
MMs01725801 | S(=O)(=O)(Nc1ncc(OCCOC)cn1)c1ccccc1 | 0.70 |