Drugs present in MMsINC which are similar to the molecule MMscode: MMs02652706
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.81 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.76 |
MMs01725425![]() | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.74 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.72 |
MMs01724755![]() | O=C(Nc1c(cccc1C)C)C(N(CCC)CC)CC | 0.72 |
MMs01726498![]() | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.72 |
MMs01726499![]() | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.72 |
MMs01727468![]() | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.72 |
MMs01725165![]() | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.72 |
MMs01725160![]() | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.71 |
MMs01724788![]() | [NH+]1(CC(c2c(C1)c(N)ccc2)c1ccccc1)C | 0.71 |
MMs01725798![]() | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.70 |