Drugs present in MMsINC which are similar to the molecule MMscode: MMs02651433
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725160 | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.78 |
MMs01724865 | Clc1cc2N=C(N3CC[NH+](CC3)C)c3c(Nc2cc1)cccc3 | 0.76 |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.75 |
MMs01725100 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01725102 | Clc1ccc(cc1)C(CC[NH+](C)C)c1ncccc1 | 0.72 |
MMs01724746 | Clc1cc2c(N(CCO)C(=O)C(O)N=C2c2ccccc2F)cc1 | 0.72 |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.70 |
MMs01725425 | [NH+](CCCN(C1Cc2c(C1)cccc2)c1ccccc1)(CC)CC | 0.70 |
MMs01727468 | [NH+](CC(CN1c2c(CCc3c1cccc3)cccc2)C)(C)C | 0.70 |