Drugs present in MMsINC which are similar to the molecule MMscode: MMs02650197
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725163 | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.79 |
MMs01725165 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC(CC1)C(=O)N | 0.74 |
MMs01725798 | O=C1N(NC(=O)C1CCCC)c1ccccc1 | 0.73 |
MMs01725819 | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.72 |
MMs01725173 | Clc1cc2N(c3c(Sc2cc1)cccc3)CCCN1CCC2(SCC(=O)N2)CC1 | 0.72 |
MMs01725160 | Clc1cc2c(N(CC(F)(F)F)C(=O)CN=C2c2ccccc2)cc1 | 0.71 |
MMs01726498 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.71 |
MMs01726499 | Clc1ccccc1C12N(CC(=O)Nc3c1cc(Cl)cc3)COC2 | 0.71 |