Drugs present in MMsINC which are similar to the molecule MMscode: MMs02643212
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725019 | S(=O)(=O)(NC)Cc1cc2c([nH]cc2CCN(C)C)cc1 | 0.75 |
MMs01725311 | S(=O)(=O)(NC(=O)c1cc(OC)c(cc1)Cc1c2cc(NC(OC3CCCC3)=O)ccc2n(c1)C)c1ccccc1C | 0.75 |
MMs01724967 | S(=O)(=O)(NC)CCc1cc2c([nH]cc2C2CCN(CC2)C)cc1 | 0.73 |
MMs01724998 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.73 |
MMs01725025 | O=C(N)c1cc2c3CC(NC)CCc3[nH]c2cc1 | 0.73 |