Drugs present in MMsINC which are similar to the molecule MMscode: MMs02639472
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.80 |
MMs01725830 | O(C)c1ccc(cc1)CC(NCC(O)c1cc(NC=O)c(O)cc1)C | 0.80 |
MMs01724842 | O(CC[N+](Cc1ccccc1)(C)C)c1ccccc1 | 0.79 |
MMs01724802 | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.76 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.75 |
MMs01724733 | O(CC(O)CNC(C)(C)C)c1c2CCC(=O)Nc2ccc1 | 0.72 |
MMs01724882 | Oc1cc([N+](CC)(C)C)ccc1 | 0.72 |
MMs01724837 | Clc1cc2c(Oc3c(N=C2N2CCNCC2)cccc3)cc1 | 0.71 |