Drugs present in MMsINC which are similar to the molecule MMscode: MMs02637372
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.80 |
MMs01727509![]() | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.77 |
MMs01725063![]() | Clc1cc(ccc1)C(=O)C(NC(C)(C)C)C | 0.73 |
MMs01725065![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725067![]() | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.72 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725545![]() | O=C(NC(C)C)c1ccc(cc1)CNNC | 0.72 |
MMs01724876![]() | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.72 |
MMs01724735![]() | Clc1ccc(cc1)C1S(=O)(=O)CCC(=O)N1C | 0.71 |
MMs01725511![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |
MMs01725513![]() | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.71 |