Drugs present in MMsINC which are similar to the molecule MMscode: MMs02635726
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725751 | Clc1cc(ccc1OCC=C)CC(O)=O | 0.78 |
MMs01725727 | ClC1(Cl)CC1c1ccc(OC(C(O)=O)(C)C)cc1 | 0.76 |
MMs01726487 | Clc1ccc(OC(C(OCCCC(=O)N(C)C)=O)(C)C)cc1 | 0.72 |
MMs01724731 | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.71 |
MMs01724736 | Clc1ccc(OCC(O)COC(=O)N)cc1 | 0.70 |