Drugs present in MMsINC which are similar to the molecule MMscode: MMs02635680
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.71 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.71 |
MMs01724729 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |
MMs01725739 | O(CC(O)CNC(C)(C)C)c1ccccc1C#N | 0.71 |