Drugs present in MMsINC which are similar to the molecule MMscode: MMs02626722
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724927 | O(C(=O)N(C)C)c1ccc[n+](c1)C | 0.80 |
MMs01725051 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.76 |
MMs01725053 | O(CC(O)CNC(C)C)c1c2c([nH]cc2)ccc1 | 0.76 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.74 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.74 |
MMs01725261 | O(CC)c1cc(ccc1OCC)Cc1nccc2c1cc(OCC)c(OCC)c2 | 0.72 |