Drugs present in MMsINC which are similar to the molecule MMscode: MMs02586013
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.77 |
MMs01725587![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](CC)(CC)C)=O | 0.75 |
MMs01725361![]() | O1Cc2c(cccc2)/C(/c2cc(ccc12)CC(O)=O)=C\CCN(C)C | 0.75 |
MMs01725262![]() | O1c2c(cccc2C(OCCN2CCCCC2)=O)C(=O)C(C)=C1c1ccccc1 | 0.73 |
MMs01726905![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)cc1)CC(N)C(O)=O | 0.73 |
MMs01725260![]() | O(C(=O)C)c1ccc(cc1)C(c1ccc(OC(=O)C)cc1)=C1CCCCC1 | 0.72 |
MMs01727511![]() | O(C(=O)C(CO)c1ccccc1)C1CC2[N+](C(C1)CC2)(Cc1ccc(OCCCC)cc1)C | 0.72 |
MMs01726904![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.72 |
MMs01726903![]() | Ic1cc(cc(I)c1Oc1cc(I)c(O)c(I)c1)CC(N)C(O)=O | 0.72 |