Drugs present in MMsINC which are similar to the molecule MMscode: MMs02579731
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725579 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.77 |
MMs01725581 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCC(O)=O)c1ccccc1 | 0.77 |
MMs01725511 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.76 |
MMs01725513 | Clc1ccc(cc1)C(N1CCN(CC1)CCOCCO)c1ccccc1 | 0.76 |
MMs01725237 | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.74 |