Drugs present in MMsINC which are similar to the molecule MMscode: MMs02578941
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725487![]() | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.78 |
MMs01724855![]() | O1Cc2c(cccc2)\C(\c2c1cccc2)=C\CCN(C)C | 0.73 |
MMs01724737![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.72 |
MMs01725786![]() | Clc1ccc(cc1)C(OCCN(C)C)(C)c1ccccc1 | 0.72 |
MMs01725084![]() | O(C(=O)C)c1cc(C(C)C)c(OCCN(C)C)cc1C | 0.72 |
MMs01724731![]() | Clc1ccc(cc1OCC(O)CNC(C)(C)C)C | 0.71 |
MMs01724802![]() | ClCCN(Cc1ccccc1)C(COc1ccccc1)C | 0.71 |
MMs01725546![]() | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.70 |