Drugs present in MMsINC which are similar to the molecule MMscode: MMs02568397
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725192 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.77 |
MMs01725202 | O1c2c(cccc2)C(O)=C(C(CC(=O)C)c2ccc([N+](=O)[O-])cc2)C1=O | 0.77 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.70 |
MMs01724724 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |
MMs01725708 | Clc1ccc(cc1)-c1oc2c(n1)cc(cc2)C(C(O)=O)C | 0.70 |