Drugs present in MMsINC which are similar to the molecule MMscode: MMs02553753
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724766 | O(Cc1ncccc1)C(=O)C(C)c1ccc(cc1)CC(C)C | 0.89 |
MMs01725112 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.88 |
MMs01724747 | O(C(C)(c1ccccc1)c1ncccc1)CCN(C)C | 0.88 |
MMs01724808 | O1c2c(cc(cc2)C(C(O)=O)C)Cc2cccnc12 | 0.74 |
MMs01726858 | Ic1cc(I)c2c(nccc2)c1O | 0.72 |
MMs01725162 | Clc1cc2c(cc1)C(c1ncccc1CC2)=C1CCN(CC1)C(OCC)=O | 0.71 |
MMs01725418 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.71 |
MMs01725203 | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.71 |
MMs01727136 | O(C(=O)c1cccnc1)CC(COC(=O)c1cccnc1)(COC(=O)c1cccnc1)COC(=O)c1cccnc1 | 0.70 |