Drugs present in MMsINC which are similar to the molecule MMscode: MMs02552443
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725817 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.83 |
MMs01724871 | O(C(=O)C(C1NCCCC1)c1ccccc1)C | 0.83 |
MMs01725745 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.79 |
MMs01725749 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.79 |
MMs01725747 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.79 |
MMs01724873 | O(C(=O)C1(CCC=CC1N(C)C)c1ccccc1)CC | 0.79 |
MMs01726866 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.73 |
MMs01726865 | Ic1c(CC(CC)C(O)=O)c(I)cc(I)c1N | 0.73 |
MMs01726872 | Ic1ccc(cc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726869 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726870 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726871 | Ic1ccccc1C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01726868 | Ic1cc(ccc1)C(CCCCCCCCC(OCC)=O)C | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |