Drugs present in MMsINC which are similar to the molecule MMscode: MMs02543202
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.84 |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.74 |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.73 |
MMs01725157 | Clc1ccc(cc1)C1(CCC1)C([NH+](C)C)CC(C)C | 0.72 |
MMs01727509 | Clc1ccccc1C[N+](CCNC(=O)C(=O)NCC[N+](Cc1ccccc1Cl)(CC)CC)(CC)CC | 0.71 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.71 |