Drugs present in MMsINC which are similar to the molecule MMscode: MMs02527076
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725187![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NCc1ccc(OCCN(C)C)cc1 | 0.73 |
MMs01725947![]() | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.73 |
MMs01726922![]() | O(C)c1cc(ccc1OC)C(OCCCCN(C(Cc1ccc(OC)cc1)C)CC)=O | 0.73 |
MMs01724825![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01725929![]() | O(C)c1c(OC)cc(cc1OC)C(=O)NC1CCCNC1 | 0.71 |
MMs01724751![]() | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.70 |
MMs01725244![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.70 |
MMs01727463![]() | O(C)c1c(OC)cc(cc1OC)C(OCC(N(C)C)(CC)c1ccccc1)=O | 0.70 |