Drugs present in MMsINC which are similar to the molecule MMscode: MMs02524434
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.80 |
MMs01726941 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1cc(N)c(cc1)C | 0.75 |
MMs01725067 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.73 |
MMs01725033 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.73 |
MMs01725065 | Clc1ccc(cc1S(=O)(=O)N)C(=O)NN1C(CCCC1C)C | 0.73 |
MMs01724754 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01725370 | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.73 |
MMs01725647 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725848 | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.73 |
MMs01725515 | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.72 |
MMs01725538 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725773 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725828 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01727287 | O(C(=O)C(NC(C(=O)N1Cc2c(CC1C(O)=O)cccc2)C)CCc1ccccc1)CC | 0.71 |
MMs01725110 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |
MMs01724773 | O=C(Nc1c(cccc1C)C)C1N(CCCC1)C | 0.71 |