Drugs present in MMsINC which are similar to the molecule MMscode: MMs02521874
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724876 | O=C1N(c2c(N(c3c1cccc3)C)cccc2)CCN(C)C | 0.78 |
MMs01724812 | Clc1cc2NC(NC(=O)c2cc1S(=O)(=O)N)CC | 0.76 |
MMs01725059 | S1c2c(N(c3c1cccc3)CCCN(C)C)cc(cc2)C(=O)C | 0.73 |
MMs01724833 | FCC1=Nc2c(cc(N)cc2)C(=O)N1c1ccccc1C | 0.72 |
MMs01724832 | S(=O)(=O)(NC(=O)NC1CCCCC1)c1ccc(cc1)C(=O)C | 0.71 |
MMs01724810 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(cc2)C(=O)CC | 0.70 |