Drugs present in MMsINC which are similar to the molecule MMscode: MMs02517202
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727181 | O1C2C34CCN(C(Cc5c3c1c(OC)cc5)C4(O)CCC2=O)C | 0.79 |
MMs01725128 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)CC=C | 0.77 |
MMs01727183 | O1C2C34CCN(C(Cc5c3c1c(O)cc5)C4(O)CCC2=O)C | 0.77 |
MMs01725152 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(OC)cc3)CCC2=O | 0.74 |
MMs01725423 | O1C2C34C(C(N(CC3)C)Cc3c4c1c(O)cc3)CCC2=O | 0.73 |