Drugs present in MMsINC which are similar to the molecule MMscode: MMs02514895
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726122 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.71 |
MMs01726123 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.71 |
MMs01726124 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.71 |
MMs01726125 | O1C2(C(OC1CCC)CC1C3C(C4(C(=CC(=O)C=C4)CC3)C)C(O)CC12C)C(=O)CO | 0.71 |
MMs01727039 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |
MMs01727040 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |
MMs01727041 | OC1CC(=O)C(CCCCCCC(OC)=O)C1\C=C\CC(O)(CCCC)C | 0.71 |