Drugs present in MMsINC which are similar to the molecule MMscode: MMs02510573
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01726120 | S(O)(=O)(=O)c1c2c(cccc2)c(N=Nc2c(O)c(cc(N=Nc3c4c(cccc4)c(S(O)(=O)=O)cc3)c2O)CO)cc1 | 0.74 |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.73 |
MMs01727561 | S(O)(=O)(=O)c1cc(S(O)(=O)=O)c2c(c1N)c(O)c(N=Nc1ccc(cc1C)-c1cc(C)c(N=Nc3ccc4c(c(N)c(S(O)(=O)=O)cc4S(O)(=O)=O)c3O)cc1)cc2 | 0.73 |
MMs01725935 | S(=O)(=O)(N)c1cc(cc(N2CCCC2)c1Oc1ccccc1)C(O)=O | 0.72 |
MMs01725941 | S(=O)(=O)(N)c1cc(cc(NCCCC)c1Oc1ccccc1)C(O)=O | 0.72 |