Drugs present in MMsINC which are similar to the molecule MMscode: MMs02508901
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727460![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.79 |
MMs01727457![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.79 |
MMs01727458![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.79 |
MMs01727459![]() | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.79 |
MMs01726551![]() | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.70 |
MMs01726552![]() | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.70 |
MMs01726553![]() | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.70 |
MMs01726554![]() | O1C2(C(OC1(C)c1ccccc1)CC1C3C(CCC12C)C1(C(=CC(=O)CC1)CC3)C)C(=O)C | 0.70 |