Drugs present in MMsINC which are similar to the molecule MMscode: MMs02502417
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725203![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.74 |
MMs01725418![]() | O(C(=O)C=1n2c3C4N(CCCC4(C=1)CC)CCc3c1c2cccc1)CC | 0.74 |
MMs01725678![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01727005![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01727007![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |
MMs01727009![]() | OCC(NC(=O)C1C=C2C(N(C1)C)Cc1c3c2cccc3n(c1)C)CC | 0.70 |