Drugs present in MMsINC which are similar to the molecule MMscode: MMs02480495
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01724851 | Clc1ccc(NC(=[NH2+])NC(=[NH2+])NC(C)C)cc1 | 0.85 |
MMs01724853 | Clc1cc(NC(=[NH2+])NC(=[NH2+])NC(C)C)ccc1Cl | 0.81 |
MMs01724959 | Clc1cccc(Cl)c1N(CC=C)C1=[NH+]CCN1 | 0.74 |
MMs01725803 | [NH+](=C(/NCc1ccccc1)\NC)/C | 0.73 |
MMs01725061 | [NH+]=1CCNC=1CN(Cc1ccccc1)c1ccccc1 | 0.72 |