Drugs present in MMsINC which are similar to the molecule MMscode: MMs02478789
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725953 | S(=O)(=O)(c1ccc(N)cc1S(=O)(=O)NC(=O)C)c1ccc(N)cc1 | 0.83 |
MMs01725656 | S(=O)(=O)(c1ccc(NCS(O)=O)cc1)c1ccc(NCS(O)=O)cc1 | 0.78 |
MMs01726782 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.70 |
MMs01726784 | S1c2c(N(c3c1cccc3)CC(N(C)C)C)cc(S(=O)(=O)N(C)C)cc2 | 0.70 |
MMs01726933 | S1c2c(N(c3c1cccc3)CCC1N(CCCC1)C)cc(S(=O)C)cc2 | 0.70 |
MMs01726935 | S1c2c(N(c3c1cccc3)CCC1N(CCCC1)C)cc(S(=O)C)cc2 | 0.70 |