Drugs present in MMsINC which are similar to the molecule MMscode: MMs02465345
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725125 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.89 |
MMs01725127 | O1C(CCC1n1c2N=CNC(=O)c2nc1)CO | 0.89 |
MMs01725527 | O=C1NC(=Nc2n(cnc12)COCCOC(=O)C(N)C(C)C)N | 0.73 |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.71 |
MMs01726464 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.71 |
MMs01726465 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.71 |
MMs01726466 | Clc1nc(N)c2ncn(c2n1)C1OC(CO)C(O)C1 | 0.71 |