Drugs present in MMsINC which are similar to the molecule MMscode: MMs02465013
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725409![]() | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.81 |
MMs01727173![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725130![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727169![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01727171![]() | Oc1ccc(cc1)C(O)C(NC(CCc1ccccc1)C)C | 0.74 |
MMs01725077![]() | Oc1cc(ccc1O)CCNC(CCc1ccc(O)cc1)C | 0.73 |
MMs01725376![]() | Oc1cc2c(CC3CCCCCC2(C)C3N)cc1 | 0.72 |
MMs01725874![]() | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |
MMs01725753![]() | O(C)c1cc(ccc1)C1(O)CCCCC1CN(C)C | 0.71 |
MMs01724795![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.71 |
MMs01726520![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.70 |
MMs01724867![]() | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.70 |
MMs01725386![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.70 |
MMs01725387![]() | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.70 |