Drugs present in MMsINC which are similar to the molecule MMscode: MMs02462861
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727726 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.82 |
MMs01727723 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.82 |
MMs01727724 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.82 |
MMs01727725 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.82 |
MMs01727108 | O(C(=O)C12CCC(CC1)(C=C2)C)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727109 | O(C(=O)C12CCC(CC1)(C=C2)C)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727110 | O(C(=O)C12CCC(CC1)(C=C2)C)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |
MMs01727111 | O(C(=O)C12CCC(CC1)(C=C2)C)C1CCC2C3C(C4C(=CC(=O)CC4)CC3)CCC12C | 0.71 |