Drugs present in MMsINC which are similar to the molecule MMscode: MMs02458549
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725809 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725833 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725954 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01725956 | O1C(CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 | 0.72 |
MMs01726741 | [n+]12c(n(N=Nn3c4[n+](cccc4)c(C)c3-c3ccccc3)c(-c3ccccc3)c1C)cccc2 | 0.71 |
MMs01725449 | OC(=O)C(NC(=O)c1ccc(N(Cc2nc3c(nc(nc3N)N)nc2)C)cc1)CCC(O)=O | 0.70 |