Drugs present in MMsINC which are similar to the molecule MMscode: MMs02457093
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726149 | OC1CC(O)C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C1=C | 0.73 |
MMs01726150 | OC1CC(O)C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C1=C | 0.73 |
MMs01726151 | OC1CC(O)C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C1=C | 0.73 |
MMs01726152 | OC1CC(O)C\C(=C/C=C/2\C3CCC(C(CCCC(O)(C)C)C)C3(CCC\2)C)\C1=C | 0.73 |
MMs01726174 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.71 |
MMs01726178 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.71 |
MMs01726180 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.71 |
MMs01726184 | OC1CC(O)C(\C=C\C(O)(CCCCC)C)C1C\C=C\CCCC(O)=O | 0.71 |