Drugs present in MMsINC which are similar to the molecule MMscode: MMs02456763
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724771 | O(CC(O)CO)c1ccccc1C | 0.80 |
MMs01725109 | O(CC(O)CO)c1ccccc1C | 0.80 |
MMs01727460 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727458 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727459 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01727457 | O1C(C(OCc2ccccc2)COCc2ccccc2)C(OCc2ccccc2)C(O)C1OCC | 0.73 |
MMs01725874 | Oc1ccc(cc1CO)C(O)CNCCCCCCOCCCCc1ccccc1 | 0.71 |
MMs01725154 | OC1CCC2C3C(CCC12C)c1c(cc(O)cc1)CC3 | 0.70 |