Drugs present in MMsINC which are similar to the molecule MMscode: MMs02455726
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727208 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.74 |
MMs01727210 | S(CC1CC2C([NH+](C1)CCC)Cc1c3c2cccc3[nH]c1)C | 0.74 |
MMs01727286 | [n+]1(c2c(cc(N(C)C)cc2)ccc1\C=C\c1cc(n(c1C)-c1ccccc1)C)C | 0.73 |
MMs01725519 | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.71 |
MMs01725521 | S1c2c(N(c3c1cccc3)CCC1[NH+](CCCC1)C)cc(SC)cc2 | 0.71 |
MMs01725411 | [NH+]1(CCC(CC1)=C1c2c(CCc3c1nccc3)cccc2)C | 0.71 |