Drugs present in MMsINC which are similar to the molecule MMscode: MMs02455235
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01727374 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.88 |
MMs01727375 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.88 |
MMs01727376 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.88 |
MMs01727373 | O1C(CO)C(O)C(O)C(NC(=O)N(N=O)C)C1O | 0.88 |
MMs01726428 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.82 |
MMs01726430 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.82 |
MMs01726431 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.82 |
MMs01726429 | ClCCN(N=O)C(=O)NC1C(O)C(O)C(OC1O)CO | 0.82 |
MMs01727714 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727692 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727694 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727696 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727698 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CN)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727708 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727710 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |
MMs01727712 | O1C(CN)C(O)C(O)C(N)C1OC1C(O)C(OC1CO)OC1C(OC2OC(CO)C(O)C(O)C2N)C(N)CC(N)C1O | 0.70 |