Drugs present in MMsINC which are similar to the molecule MMscode: MMs02454619
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724860 | Clc1ccccc1CC([NH3+])(C)C | 0.79 |
MMs01726924 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.77 |
MMs01725221 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1cc(ccc1)C)c1ccccc1 | 0.77 |
MMs01727349 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.75 |
MMs01725704 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.75 |
MMs01727347 | Clc1cc(ccc1Cl)C1CCC([NH2+]C)c2c1cccc2 | 0.75 |
MMs01725575 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.74 |
MMs01725577 | Clc1ccc(cc1)C(N1CCN(CC1)Cc1ccc(cc1)C(C)(C)C)c1ccccc1 | 0.74 |