Drugs present in MMsINC which are similar to the molecule MMscode: MMs02452370
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725143![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.75 |
MMs01724784![]() | O(C)c1ccc(OC)cc1C(O)CNC(=O)CN | 0.75 |
MMs01726749![]() | FC(F)(F)COc1ccc(OCC(F)(F)F)cc1C(=O)NCC1NCCCC1 | 0.73 |
MMs01725104![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.73 |
MMs01725015![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CC(=O)N | 0.73 |
MMs01725375![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01724775![]() | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.72 |
MMs01724749![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |
MMs01725292![]() | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.71 |