Drugs present in MMsINC which are similar to the molecule MMscode: MMs02448535
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725071 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.78 |
MMs01725069 | Clc1ccccc1C(O)(CCN(C)C)c1ccccc1 | 0.78 |
MMs01725409 | Oc1ccc(cc1C(CCN(C(C)C)C(C)C)c1ccccc1)C | 0.78 |
MMs01724795 | Oc1cc2c(CC3N(CCC2(C)C3C)CC=C(C)C)cc1 | 0.73 |
MMs01725386 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01725387 | OC(CC[N+](CC)(CC)CC)(C1CCCCC1)c1ccccc1 | 0.73 |
MMs01724867 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.71 |
MMs01726520 | Oc1cc2c(CC3N(CCC2(C)C3C)CC2CC2)cc1 | 0.71 |
MMs01724857 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01726473 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01725133 | Clc1ccc(cc1)C(OCCC1N(CCC1)C)(C)c1ccccc1 | 0.71 |
MMs01725087 | OC(CCN1CCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725397 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |
MMs01725399 | OC(CCN1CCCCC1)(C1CCCCC1)c1ccccc1 | 0.71 |