Drugs present in MMsINC which are similar to the molecule MMscode: MMs02446425
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01727723 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727724 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727725 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727726 | O1C(C)C(O)C(O)C(O)C1OC1CCC2(C3C(CCC2=C1)C1(O)CCC(C1(CC3)C)C=1C=CC(OC=1)=O)C | 0.72 |
MMs01727690 | O1C(C)C(O)C(N)C(O)C1OC1\C=C\C=C\C=C\C=C\CC(OC(=O)\C=C\C2OC2CC(O)CC2(OC(C1)C(C(O)=O)C(O)C2)O)C | 0.70 |
MMs01727691 | O1C(C)C(O)C(N)C(O)C1OC1\C=C\C=C\C=C\C=C\CC(OC(=O)\C=C\C2OC2CC(O)CC2(OC(C1)C(C(O)=O)C(O)C2)O)C | 0.70 |