Drugs present in MMsINC which are similar to the molecule MMscode: MMs02443587
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01724800 | O1CCNC(C)C1c1ccccc1 | 0.74 |
MMs01725049 | O(C(c1ccccc1)c1ccccc1)C1CCN(CC1)C | 0.72 |
MMs01725734 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725735 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725733 | O(C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC)C(=O)C | 0.71 |
MMs01725147 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |
MMs01724804 | OC(C1NCCCC1)(c1ccccc1)c1ccccc1 | 0.71 |