Drugs present in MMsINC which are similar to the molecule MMscode: MMs02443075
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
| Drug | SMILES | Tanimoto |
|---|---|---|
| Drug | SMILES name | Tanimoto |
MMs01725923 | Oc1ccc(N=Nc2cc(C(O)=O)c(O)cc2)cc1C(O)=O | 0.78 |
MMs01724913 | O1c2c(OC1)cc1N(C=C(C(O)=O)C(=O)c1c2)CC | 0.74 |
MMs01724975 | Oc1c([N+](=O)[O-])cc(cc1O)C(=O)c1ccc(cc1)C | 0.73 |
MMs01724841 | O(C(=O)C)c1ccccc1C(Oc1ccc(NC(=O)C)cc1)=O | 0.72 |
MMs01725036 | O1c2c(OC1)cc1N(N=C(C(O)=O)C(=O)c1c2)CC | 0.71 |
MMs01724751 | O(C)c1cc(ccc1O)C(=O)N(CC)CC | 0.71 |