Drugs present in MMsINC which are similar to the molecule MMscode: MMs02442748
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725292 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01724749 | O(CC(O)CNC(C)C)c1ccc(cc1)CCC(OC)=O | 0.74 |
MMs01725546 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](C(C)C)(C(C)C)C)=O | 0.71 |
MMs01725487 | Cl\C(=C(\c1ccc(OCCN(CC)CC)cc1)/c1ccccc1)\c1ccccc1 | 0.71 |
MMs01725260 | O(C(=O)C)c1ccc(cc1)C(c1ccc(OC(=O)C)cc1)=C1CCCCC1 | 0.71 |
MMs01724919 | O(CCN(C)C)c1ccccc1Cc1ccccc1 | 0.71 |
MMs01725603 | ClCC\C(=C(/c1ccc(OCCN(C)C)cc1)\c1ccccc1)\c1ccccc1 | 0.71 |
MMs01725375 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01724775 | O1C(CNC1=O)COc1cc(cc(c1)C)C | 0.71 |
MMs01726886 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01725840 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726882 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01726884 | O(CC(NC(C(O)c1ccc(O)cc1)C)C)c1ccccc1 | 0.71 |
MMs01725532 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725530 | O(CC(O)CNC(C)C)c1ccc(cc1)CCOC | 0.70 |
MMs01725116 | O(C)c1ccccc1CC(NC)C | 0.70 |
MMs01724780 | O(C)c1ccccc1CC(NC)C | 0.70 |
MMs01725587 | O1c2c(cccc2)C(c2c1cccc2)C(OCC[N+](CC)(CC)C)=O | 0.70 |