Drugs present in MMsINC which are similar to the molecule MMscode: MMs02441021
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725588![]() | Clc1cc(N)ccc1C(OCCN(CC)CC)=O | 0.79 |
MMs01725237![]() | Clc1cccc(NC(=O)c2ccccc2)c1CN(CC(=O)N1CCOCC1)C | 0.72 |
MMs01726609![]() | Ic1c(C(O)=O)c(I)c(NC(=O)C)cc1NC(=O)C | 0.71 |
MMs01725741![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01724806![]() | Clc1cc(ccc1N1CC=CC1)C(C(O)=O)C | 0.71 |
MMs01727179![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.70 |
MMs01727180![]() | Clc1cc2c(NC(=O)CN3CC(OC23c2ccccc2)C)cc1 | 0.70 |