Drugs present in MMsINC which are similar to the molecule MMscode: MMs02437975
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01726771 | FC12C(C3CCC(O)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.71 |
MMs01726772 | FC12C(C3CCC(O)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.71 |
MMs01726773 | FC12C(C3CCC(O)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.71 |
MMs01726774 | FC12C(C3CCC(O)(C(=O)COC(=O)C)C3(CC1O)C)CCC1=CC(=O)CCC12C | 0.71 |
MMs01727175 | O1CC2(C(CC1=O)CCC1C3CCC(O)(C)C3(CCC12)C)C | 0.71 |
MMs01727176 | O1CC2(C(CC1=O)CCC1C3CCC(O)(C)C3(CCC12)C)C | 0.71 |
MMs01727177 | O1CC2(C(CC1=O)CCC1C3CCC(O)(C)C3(CCC12)C)C | 0.71 |
MMs01727178 | O1CC2(C(CC1=O)CCC1C3CCC(O)(C)C3(CCC12)C)C | 0.71 |