Drugs present in MMsINC which are similar to the molecule MMscode: MMs02435411
You can sort the columns by MMscode and Tanimoto.
You can sort the columns by MMscode and Tanimoto.
Drug | SMILES | Tanimoto |
---|---|---|
Drug | SMILES name | Tanimoto |
MMs01725769![]() | O1CCN(CC1)CCC1CN(CC)C(=O)C1(c1ccccc1)c1ccccc1 | 0.88 |
MMs01725161![]() | O1CCN(CC1)CC(C(C(=O)N1CCCC1)(c1ccccc1)c1ccccc1)C | 0.86 |
MMs01725848![]() | O=C1NC(=O)CCC1(CCN(CC)CC)c1ccccc1 | 0.84 |
MMs01725515![]() | O=C(N)C(CC[N+](C(C)C)(C(C)C)C)(c1ccccc1)c1ccccc1 | 0.80 |
MMs01725525![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.77 |
MMs01725524![]() | O=C(C(CC(N(C)C)C)(c1ccccc1)c1ccccc1)CC | 0.77 |
MMs01724754![]() | O=C1N(CC)C(=O)NC1c1ccccc1 | 0.75 |
MMs01725819![]() | O=C(N(C1CCN(CC1)CCc1ccccc1)c1ccccc1)CC | 0.73 |
MMs01725092![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725094![]() | O=C(C(CN1CCCCC1)C)c1ccc(cc1)C | 0.72 |
MMs01725163![]() | Clc1ccc(N(C(=O)Cc2ccccc2)C2CCN(CC2)C(C)C)cc1 | 0.71 |
MMs01725440![]() | [N+]1(CCC(CC1)=C(c1ccccc1)c1ccccc1)(C)C | 0.70 |